C21H33NO2 — CID 91741629
(E,3R,8R,9S,10R,13S,14S)-N,3-dimethoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-imine (PubChem CID 91741629) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is (E,3R,8R,9S,10R,13S,14S)-N,3-dimethoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-imine.
| Compound Name | (E,3R,8R,9S,10R,13S,14S)-N,3-dimethoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-imine |
|---|---|
| PubChem CID | 91741629 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | (E,3R,8R,9S,10R,13S,14S)-N,3-dimethoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-imine |
| SMILES | CO/N=C1\CC[C@H]2[C@@H]3CC=C4C[C@H](OC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H33NO2/c1-20-11-9-15(23-3)13-14(20)5-6-16-17-7-8-19(22-24-4)21(17,2)12-10-18(16)20/h5,15-18H,6-13H2,1-4H3/b22-19+/t15-,16+,17+,18+,20+,21+/m1/s1 |
| InChIKey | AWWUTKNNAMBZDP-ZHWLLIPASA-N |
| XLogP | 4.97 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|