C21H34O — CID 58240606
(8S,10aR,12aS)-8-methoxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,7,8,9,10,10b,11,12-tetradecahydrochrysene (PubChem CID 58240606) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (8S,10aR,12aS)-8-methoxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,7,8,9,10,10b,11,12-tetradecahydrochrysene.
| Compound Name | (8S,10aR,12aS)-8-methoxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,7,8,9,10,10b,11,12-tetradecahydrochrysene |
|---|---|
| PubChem CID | 58240606 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (8S,10aR,12aS)-8-methoxy-10a,12a-dimethyl-1,2,3,4,4a,4b,5,7,8,9,10,10b,11,12-tetradecahydrochrysene |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CCC3C4CCCC[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C21H34O/c1-20-11-5-4-6-18(20)17-8-7-15-14-16(22-3)9-13-21(15,2)19(17)10-12-20/h7,16-19H,4-6,8-14H2,1-3H3/t16-,17?,18?,19?,20-,21-/m0/s1 |
| InChIKey | HFXVDVGPDPPLGB-RYHLCRTJSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|