C22H36O2 — CID 167070341
(3S,10R,13S,17S)-3,17-dimethoxy-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 167070341) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (3S,10R,13S,17S)-3,17-dimethoxy-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3S,10R,13S,17S)-3,17-dimethoxy-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 167070341 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (3S,10R,13S,17S)-3,17-dimethoxy-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@]2(C)OC)C1 |
| InChI | InChI=1S/C22H36O2/c1-20-11-8-16(23-4)14-15(20)6-7-17-18(20)9-12-21(2)19(17)10-13-22(21,3)24-5/h6,16-19H,7-14H2,1-5H3/t16-,17?,18?,19?,20-,21-,22-/m0/s1 |
| InChIKey | WYMDZSSNCHQTTR-ALTMMPCJSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|