C20H30O3 — CID 3580302
17-hydroxy-3-methoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one (PubChem CID 3580302) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 17-hydroxy-3-methoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | 17-hydroxy-3-methoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 3580302 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 17-hydroxy-3-methoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| SMILES | COC1CCC2(C)C(=CCC3C2CCC2(C)C(O)C(=O)CC32)C1 |
| InChI | InChI=1S/C20H30O3/c1-19-8-6-13(23-3)10-12(19)4-5-14-15(19)7-9-20(2)16(14)11-17(21)18(20)22/h4,13-16,18,22H,5-11H2,1-3H3 |
| InChIKey | FTVVRNPVTQSSQO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|