C21H34O2 — CID 99575390
(3S,8S,9S,10R,13R,14S,16R)-3-methoxy-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-ol (PubChem CID 99575390) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,16R)-3-methoxy-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,16R)-3-methoxy-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 99575390 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,16R)-3-methoxy-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-ol |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4C[C@@](C)(O)C[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C21H34O2/c1-19-9-8-17-16(18(19)12-20(2,22)13-19)6-5-14-11-15(23-4)7-10-21(14,17)3/h5,15-18,22H,6-13H2,1-4H3/t15-,16+,17-,18-,19+,20+,21-/m0/s1 |
| InChIKey | ATOJYLFXZWAWCW-LGCDCWIJSA-N |
| XLogP | 4.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|