C27H34O3 — CID 177275614
[(3S,10R,13S)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 177275614) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is [(3S,10R,13S)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(3S,10R,13S)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 177275614 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | [(3S,10R,13S)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@]2(C)C(OC(=O)c4ccccc4)=CCC32)C1 |
| InChI | InChI=1S/C27H34O3/c1-26-15-13-20(29-3)17-19(26)9-10-21-22-11-12-24(27(22,2)16-14-23(21)26)30-25(28)18-7-5-4-6-8-18/h4-9,12,20-23H,10-11,13-17H2,1-3H3/t20-,21?,22?,23?,26-,27-/m0/s1 |
| InChIKey | PNYYANAIMFFBNW-PVZVGWETSA-N |
| XLogP | 6.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|