C33H38O4 — CID 28816264
[(3S,8R,9S,10R,13S,14S,17S)-17-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 28816264) has the molecular formula C33H38O4 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,17S)-17-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,17S)-17-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 28816264 |
| Molecular Formula | C33H38O4 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,17S)-17-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](OC(=O)c5ccccc5)CC[C@@]43C)[C@@H]1CC[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H38O4/c1-32-19-17-25(36-30(34)22-9-5-3-6-10-22)21-24(32)13-14-26-27-15-16-29(33(27,2)20-18-28(26)32)37-31(35)23-11-7-4-8-12-23/h3-13,25-29H,14-21H2,1-2H3/t25-,26-,27-,28-,29-,32-,33-/m0/s1 |
| InChIKey | WXPROVOMHYNFTO-HFETUNNBSA-N |
| XLogP | 7.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|