C29H38O4 — CID 59006261
ethyl (3S,10R,13S,17S)-3-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 59006261) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is ethyl (3S,10R,13S,17S)-3-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | ethyl (3S,10R,13S,17S)-3-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 59006261 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | ethyl (3S,10R,13S,17S)-3-benzoyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC2C3CC=C4C[C@@H](OC(=O)c5ccccc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H38O4/c1-4-32-27(31)25-13-12-23-22-11-10-20-18-21(33-26(30)19-8-6-5-7-9-19)14-16-28(20,2)24(22)15-17-29(23,25)3/h5-10,21-25H,4,11-18H2,1-3H3/t21-,22?,23?,24?,25+,28-,29-/m0/s1 |
| InChIKey | JXRLCPLWVXYLSM-NEJUIZGISA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|