C28H35IO3 — CID 3657674
(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) 3-iodobenzoate (PubChem CID 3657674) has the molecular formula C28H35IO3 and a molecular weight of 546.49 g/mol. Its IUPAC name is (17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) 3-iodobenzoate.
| Compound Name | (17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) 3-iodobenzoate |
|---|---|
| PubChem CID | 3657674 |
| Molecular Formula | C28H35IO3 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | (17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) 3-iodobenzoate |
| SMILES | CC(=O)C1CCC2C3CC=C4CC(OC(=O)c5cccc(I)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H35IO3/c1-17(30)23-9-10-24-22-8-7-19-16-21(32-26(31)18-5-4-6-20(29)15-18)11-13-27(19,2)25(22)12-14-28(23,24)3/h4-7,15,21-25H,8-14,16H2,1-3H3 |
| InChIKey | ZQIAUMJMNRWQQO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|