C44H62O6 — CID 53468674
bis(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) oxalate (PubChem CID 53468674) has the molecular formula C44H62O6 and a molecular weight of 686.97 g/mol. Its IUPAC name is bis(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) oxalate.
| Compound Name | bis(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) oxalate |
|---|---|
| PubChem CID | 53468674 |
| Molecular Formula | C44H62O6 |
| Molecular Weight | 686.97 g/mol |
| Exact Mass | 686.45 |
| IUPAC Name | bis(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) oxalate |
| SMILES | CC(=O)C1CCC2C3CC=C4CC(OC(=O)C(=O)OC5CCC6(C)C(=CCC7C6CCC6(C)C(C(C)=O)CCC76)C5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C44H62O6/c1-25(45)33-11-13-35-31-9-7-27-23-29(15-19-41(27,3)37(31)17-21-43(33,35)5)49-39(47)40(48)50-30-16-20-42(4)28(24-30)8-10-32-36-14-12-34(26(2)46)44(36,6)22-18-38(32)42/h7-8,29-38H,9-24H2,1-6H3 |
| InChIKey | IFBXUNGEAANPJW-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.97 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|