C21H31O2Si — CID 59761024
CID 59761024 (PubChem CID 59761024) has the molecular formula C21H31O2Si and a molecular weight of 343.56 g/mol.
| Compound Name | CID 59761024 |
|---|---|
| PubChem CID | 59761024 |
| Molecular Formula | C21H31O2Si |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | — |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O[Si])CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31O2Si/c1-13(22)17-6-7-18-16-5-4-14-12-15(23-24)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,15-19H,5-12H2,1-3H3/t15?,16-,17+,18-,19-,20-,21+/m0/s1 |
| InChIKey | CGBVMHMGZZYPSJ-OZIWPBGVSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|