C27H40O6 — CID 131877189
ethyl 3-[(3S,8S,9S,10R,13S,14S,17S)-3-ethoxycarbonyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-oxopropanoate (PubChem CID 131877189) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is ethyl 3-[(3S,8S,9S,10R,13S,14S,17S)-3-ethoxycarbonyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[(3S,8S,9S,10R,13S,14S,17S)-3-ethoxycarbonyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 131877189 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | ethyl 3-[(3S,8S,9S,10R,13S,14S,17S)-3-ethoxycarbonyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)OCC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H40O6/c1-5-31-24(29)16-23(28)22-10-9-20-19-8-7-17-15-18(33-25(30)32-6-2)11-13-26(17,3)21(19)12-14-27(20,22)4/h7,18-22H,5-6,8-16H2,1-4H3/t18-,19-,20-,21-,22+,26-,27-/m0/s1 |
| InChIKey | UEGJKZYUOIFUGL-DAVDRHTJSA-N |
| XLogP | 5.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|