C28H48N2O2+2 — CID 11874533
CID 11874533 (PubChem CID 11874533) has the molecular formula C28H48N2O2+2 and a molecular weight of 444.70 g/mol.
| Compound Name | CID 11874533 |
|---|---|
| PubChem CID | 11874533 |
| Molecular Formula | C28H48N2O2+2 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.37 |
| IUPAC Name | — |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@H]4CC[C@]5(C[NH+](C)C6(CC[NH+](C)CC6)O5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H46N2O2/c1-25-11-8-21(31-5)18-20(25)6-7-22-23(25)9-12-26(2)24(22)10-13-27(26)19-30(4)28(32-27)14-16-29(3)17-15-28/h6,21-24H,7-19H2,1-5H3/p+2/t21-,22+,23-,24+,25-,26-,27-/m0/s1 |
| InChIKey | YKZPJVAZIXEHHB-UBFNPNKOSA-P |
| XLogP | 2.25 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|