C19H29F — CID 54476050
(3S,8S,9S,10R,13S,14S)-3-fluoro-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 54476050) has the molecular formula C19H29F and a molecular weight of 276.44 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S)-3-fluoro-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8S,9S,10R,13S,14S)-3-fluoro-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 54476050 |
| Molecular Formula | C19H29F |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S)-3-fluoro-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC=C3C[C@@H](F)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H29F/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h5,14-17H,3-4,6-12H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | XLQLNZMROXUGRF-DYKIIFRCSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|