C21H29F3O2 — CID 99572059
[(3R,8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate (PubChem CID 99572059) has the molecular formula C21H29F3O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3R,8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 99572059 |
| Molecular Formula | C21H29F3O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [(3R,8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC=C3C[C@H](OC(=O)C(F)(F)F)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C21H29F3O2/c1-19-9-3-4-16(19)15-6-5-13-12-14(26-18(25)21(22,23)24)7-11-20(13,2)17(15)8-10-19/h5,14-17H,3-4,6-12H2,1-2H3/t14-,15+,16+,17+,19+,20+/m1/s1 |
| InChIKey | OGQQARADPATKJB-YLQUGHGXSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|