C23H28F6O4 — CID 91749023
[(3S,10R,13S,17R)-10,13-dimethyl-17-(2,2,2-trifluoroacetyl)oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate (PubChem CID 91749023) has the molecular formula C23H28F6O4 and a molecular weight of 482.46 g/mol. Its IUPAC name is [(3S,10R,13S,17R)-10,13-dimethyl-17-(2,2,2-trifluoroacetyl)oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S,10R,13S,17R)-10,13-dimethyl-17-(2,2,2-trifluoroacetyl)oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91749023 |
| Molecular Formula | C23H28F6O4 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [(3S,10R,13S,17R)-10,13-dimethyl-17-(2,2,2-trifluoroacetyl)oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@]12CC[C@H](OC(=O)C(F)(F)F)CC1=CCC1C2CC[C@@]2(C)C1CC[C@H]2OC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H28F6O4/c1-20-9-7-13(32-18(30)22(24,25)26)11-12(20)3-4-14-15-5-6-17(33-19(31)23(27,28)29)21(15,2)10-8-16(14)20/h3,13-17H,4-11H2,1-2H3/t13-,14?,15?,16?,17+,20-,21-/m0/s1 |
| InChIKey | OAFQCHNBNINGJD-NYBYHMMSSA-N |
| XLogP | 5.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|