C24H34F3NO3 — CID 91701331
[17-[(E)-N-methoxy-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate (PubChem CID 91701331) has the molecular formula C24H34F3NO3 and a molecular weight of 441.53 g/mol. Its IUPAC name is [17-[(E)-N-methoxy-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [17-[(E)-N-methoxy-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91701331 |
| Molecular Formula | C24H34F3NO3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | [17-[(E)-N-methoxy-C-methylcarbonimidoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CO/N=C(\C)C1CCC2C3CC=C4CC(OC(=O)C(F)(F)F)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C24H34F3NO3/c1-14(28-30-4)18-7-8-19-17-6-5-15-13-16(31-21(29)24(25,26)27)9-11-22(15,2)20(17)10-12-23(18,19)3/h5,16-20H,6-13H2,1-4H3/b28-14+ |
| InChIKey | FFTMAPAWYFINLB-CCVNUDIWSA-N |
| XLogP | 6.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|