C22H27F5O3 — CID 91740074
(10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91740074) has the molecular formula C22H27F5O3 and a molecular weight of 434.45 g/mol. Its IUPAC name is (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91740074 |
| Molecular Formula | C22H27F5O3 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CC12CCC3C(CC=C4CC(OC(=O)C(F)(F)C(F)(F)F)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C22H27F5O3/c1-19-9-7-13(30-18(29)21(23,24)22(25,26)27)11-12(19)3-4-14-15-5-6-17(28)20(15,2)10-8-16(14)19/h3,13-16H,4-11H2,1-2H3 |
| InChIKey | WQVZUVYAIXHPIW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|