C19H30N4 — CID 172962766
(E)-[(3Z,8R,9S,10R,13S,14R)-3-hydrazinylidene-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]hydrazine (PubChem CID 172962766) has the molecular formula C19H30N4 and a molecular weight of 314.48 g/mol. Its IUPAC name is (E)-[(3Z,8R,9S,10R,13S,14R)-3-hydrazinylidene-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]hydrazine.
| Compound Name | (E)-[(3Z,8R,9S,10R,13S,14R)-3-hydrazinylidene-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]hydrazine |
|---|---|
| PubChem CID | 172962766 |
| Molecular Formula | C19H30N4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (E)-[(3Z,8R,9S,10R,13S,14R)-3-hydrazinylidene-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]hydrazine |
| SMILES | C[C@]12CC/C(=N/N)C=C1CC[C@H]1[C@H]3CC/C(=N\N)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C19H30N4/c1-18-9-7-13(22-20)11-12(18)3-4-14-15-5-6-17(23-21)19(15,2)10-8-16(14)18/h11,14-16H,3-10,20-21H2,1-2H3/b22-13-,23-17+/t14-,15+,16-,18-,19-/m0/s1 |
| InChIKey | PINUESXRWZTPOZ-BGJFKYBCSA-N |
| XLogP | 3.58 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|