C21H34N4 — CID 7464583
(E)-[(8S,9R,10S,13S,14S,17R)-17-ethanehydrazonoyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydrazine (PubChem CID 7464583) has the molecular formula C21H34N4 and a molecular weight of 342.53 g/mol. Its IUPAC name is (E)-[(8S,9R,10S,13S,14S,17R)-17-ethanehydrazonoyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydrazine.
| Compound Name | (E)-[(8S,9R,10S,13S,14S,17R)-17-ethanehydrazonoyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydrazine |
|---|---|
| PubChem CID | 7464583 |
| Molecular Formula | C21H34N4 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | (E)-[(8S,9R,10S,13S,14S,17R)-17-ethanehydrazonoyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydrazine |
| SMILES | C/C(=N/N)[C@@H]1CC[C@H]2[C@@H]3CCC4=C/C(=N/N)CC[C@@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C21H34N4/c1-13(24-22)17-6-7-18-16-5-4-14-12-15(25-23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11,22-23H2,1-3H3/b24-13-,25-15+/t16-,17-,18-,19+,20+,21+/m0/s1 |
| InChIKey | WVLSVRGWXOQKDI-IRYOBLKESA-N |
| XLogP | 4.21 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|