C21H32N6OS — CID 172986154
[(Z)-[(10R,13S)-17-(carbamothioylhydrazinylidene)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]urea (PubChem CID 172986154) has the molecular formula C21H32N6OS and a molecular weight of 416.60 g/mol. Its IUPAC name is [(Z)-[(10R,13S)-17-(carbamothioylhydrazinylidene)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]urea.
| Compound Name | [(Z)-[(10R,13S)-17-(carbamothioylhydrazinylidene)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 172986154 |
| Molecular Formula | C21H32N6OS |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [(Z)-[(10R,13S)-17-(carbamothioylhydrazinylidene)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]urea |
| SMILES | C[C@]12CC/C(=N/NC(N)=O)C=C1CCC1C2CC[C@]2(C)C(=NNC(N)=S)CCC12 |
| InChI | InChI=1S/C21H32N6OS/c1-20-9-7-13(24-26-18(22)28)11-12(20)3-4-14-15-5-6-17(25-27-19(23)29)21(15,2)10-8-16(14)20/h11,14-16H,3-10H2,1-2H3,(H3,22,26,28)(H3,23,27,29)/b24-13-,25-17?/t14?,15?,16?,20-,21-/m0/s1 |
| InChIKey | VRARBZPXAFLRSH-KQYCIJBUSA-N |
| XLogP | 3.16 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|