C20H31N3O — CID 6030056
[(E)-(10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]urea (PubChem CID 6030056) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is [(E)-(10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]urea.
| Compound Name | [(E)-(10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]urea |
|---|---|
| PubChem CID | 6030056 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | [(E)-(10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]urea |
| SMILES | CC12CCCC1C1CCC3=C/C(=N/NC(N)=O)CCC3(C)C1CC2 |
| InChI | InChI=1S/C20H31N3O/c1-19-9-3-4-16(19)15-6-5-13-12-14(22-23-18(21)24)7-11-20(13,2)17(15)8-10-19/h12,15-17H,3-11H2,1-2H3,(H3,21,23,24)/b22-14+ |
| InChIKey | ITUZGSVPOXPKFO-HYARGMPZSA-N |
| XLogP | 4.36 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|