C20H27ClO2 — CID 57025590
(8S,9R,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carbonyl chloride (PubChem CID 57025590) has the molecular formula C20H27ClO2 and a molecular weight of 334.89 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carbonyl chloride.
| Compound Name | (8S,9R,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carbonyl chloride |
|---|---|
| PubChem CID | 57025590 |
| Molecular Formula | C20H27ClO2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (8S,9R,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carbonyl chloride |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C(C(=O)Cl)C[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C20H27ClO2/c1-19-8-3-4-15(19)13-6-5-12-10-17(22)14(18(21)23)11-20(12,2)16(13)7-9-19/h10,13-16H,3-9,11H2,1-2H3/t13-,14?,15-,16+,19-,20-/m0/s1 |
| InChIKey | ATRISLZYJCXJSC-FSIHYXCMSA-N |
| XLogP | 4.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|