C19H28O4 — CID 121452154
(8S,9S,10R,13S,14S)-1,1,2-trihydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-3-one (PubChem CID 121452154) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-1,1,2-trihydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S)-1,1,2-trihydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 121452154 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (8S,9S,10R,13S,14S)-1,1,2-trihydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C(O)C(O)(O)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H28O4/c1-17-8-3-4-13(17)12-6-5-11-10-15(20)16(21)19(22,23)18(11,2)14(12)7-9-17/h10,12-14,16,21-23H,3-9H2,1-2H3/t12-,13-,14-,16?,17-,18-/m0/s1 |
| InChIKey | GHDCKXQXVUOWCZ-LBAWMQNJSA-N |
| XLogP | 2.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|