C19H25FO2 — CID 123799041
(8S,9S,10S,13S,14S)-2-fluoro-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 123799041) has the molecular formula C19H25FO2 and a molecular weight of 304.40 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-2-fluoro-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10S,13S,14S)-2-fluoro-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123799041 |
| Molecular Formula | C19H25FO2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (8S,9S,10S,13S,14S)-2-fluoro-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C(F)=C[C@]3(C)[C@H]1C(O)C2 |
| InChI | InChI=1S/C19H25FO2/c1-18-7-3-4-13(18)12-6-5-11-8-15(21)14(20)9-19(11,2)17(12)16(22)10-18/h8-9,12-13,16-17,22H,3-7,10H2,1-2H3/t12-,13-,16?,17+,18-,19-/m0/s1 |
| InChIKey | YCWRAJLZDYCAMR-YNLAKYLISA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|