C20H26O5 — CID 91519810
(8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylic acid (PubChem CID 91519810) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylic acid.
| Compound Name | (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 91519810 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylic acid |
| SMILES | C[C@]12C=C(C(=O)O)C(=O)C=C1CC[C@@H]1[C@H]2C(O)C[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C20H26O5/c1-19-8-12(18(24)25)14(21)7-10(19)3-4-11-13-5-6-16(23)20(13,2)9-15(22)17(11)19/h7-8,11,13,15-17,22-23H,3-6,9H2,1-2H3,(H,24,25)/t11-,13-,15?,16?,17-,19-,20-/m0/s1 |
| InChIKey | JHGRYRDKEKMZBG-CTQWKYIKSA-N |
| XLogP | 2.08 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|