C20H26O3S — CID 142109511
11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 142109511) has the molecular formula C20H26O3S and a molecular weight of 346.49 g/mol. Its IUPAC name is 11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | 11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 142109511 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C(C(=O)S)CCC12 |
| InChI | InChI=1S/C20H26O3S/c1-19-8-7-12(21)9-11(19)3-4-13-14-5-6-15(18(23)24)20(14,2)10-16(22)17(13)19/h7-9,13-17,22H,3-6,10H2,1-2H3,(H,23,24) |
| InChIKey | KLEVWAYJOHJNOY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|