C23H30O4 — CID 143220841
acetylene;methyl (13S,17S)-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 143220841) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is acetylene;methyl (13S,17S)-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | acetylene;methyl (13S,17S)-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 143220841 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | acetylene;methyl (13S,17S)-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | C#C.COC(=O)[C@H]1CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)C[C@@]21C |
| InChI | InChI=1S/C21H28O4.C2H2/c1-20-9-8-13(22)10-12(20)4-5-14-15-6-7-16(19(24)25-3)21(15,2)11-17(23)18(14)20;1-2/h8-10,14-18,23H,4-7,11H2,1-3H3;1-2H/t14?,15?,16-,17?,18?,20?,21+;/m1./s1 |
| InChIKey | CHEBUIKAVQJXDY-FXTHERMQSA-N |
| XLogP | 3.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|