C24H32O4 — CID 143220879
acetylene;methyl (17S)-11-hydroxy-6,10,13-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 143220879) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is acetylene;methyl (17S)-11-hydroxy-6,10,13-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | acetylene;methyl (17S)-11-hydroxy-6,10,13-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 143220879 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | acetylene;methyl (17S)-11-hydroxy-6,10,13-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | C#C.COC(=O)[C@H]1CCC2C3CC(C)C4=CC(=O)C=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C22H30O4.C2H2/c1-12-9-14-15-5-6-16(20(25)26-4)22(15,3)11-18(24)19(14)21(2)8-7-13(23)10-17(12)21;1-2/h7-8,10,12,14-16,18-19,24H,5-6,9,11H2,1-4H3;1-2H/t12?,14?,15?,16-,18?,19?,21?,22?;/m1./s1 |
| InChIKey | WZVMXPBGAZYRQO-RZCDLVOKSA-N |
| XLogP | 3.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|