C22H30O5 — CID 175674763
(6S,8S,9S,10R,11S,13S,14S,17S)-17-(2,2-dihydroxyacetyl)-11-hydroxy-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 175674763) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (6S,8S,9S,10R,11S,13S,14S,17S)-17-(2,2-dihydroxyacetyl)-11-hydroxy-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9S,10R,11S,13S,14S,17S)-17-(2,2-dihydroxyacetyl)-11-hydroxy-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 175674763 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (6S,8S,9S,10R,11S,13S,14S,17S)-17-(2,2-dihydroxyacetyl)-11-hydroxy-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H]1C[C@@H]2[C@H]([C@@H](O)C[C@]3(C)[C@@H](C(=O)C(O)O)CC[C@@H]23)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C22H30O5/c1-11-8-13-14-4-5-15(19(25)20(26)27)22(14,3)10-17(24)18(13)21(2)7-6-12(23)9-16(11)21/h6-7,9,11,13-15,17-18,20,24,26-27H,4-5,8,10H2,1-3H3/t11-,13-,14-,15+,17-,18+,21-,22-/m0/s1 |
| InChIKey | NJAADXDEXDYVML-DWAHBEQWSA-N |
| XLogP | 2.01 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|