C22H30O4 — CID 154427627
(6S,8S,9S,10R,13S,14S,17S)-17-(2,2-dihydroxyacetyl)-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154427627) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (6S,8S,9S,10R,13S,14S,17S)-17-(2,2-dihydroxyacetyl)-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9S,10R,13S,14S,17S)-17-(2,2-dihydroxyacetyl)-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154427627 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (6S,8S,9S,10R,13S,14S,17S)-17-(2,2-dihydroxyacetyl)-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CC[C@H](C(=O)C(O)O)[C@@]3(C)CC[C@@H]2[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C22H30O4/c1-12-10-14-15-4-5-17(19(24)20(25)26)21(15,2)9-7-16(14)22(3)8-6-13(23)11-18(12)22/h6,8,11-12,14-17,20,25-26H,4-5,7,9-10H2,1-3H3/t12-,14-,15-,16-,17+,21-,22+/m0/s1 |
| InChIKey | KRWRKBGCHCCZGL-KXSVHEDMSA-N |
| XLogP | 3.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|