C26H35ClO5 — CID 56605655
[2-[(6S,8S,9S,10R,13S,14S,17S)-6-chloro-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-hydroxy-2-methylbutanoate (PubChem CID 56605655) has the molecular formula C26H35ClO5 and a molecular weight of 463.01 g/mol. Its IUPAC name is [2-[(6S,8S,9S,10R,13S,14S,17S)-6-chloro-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-hydroxy-2-methylbutanoate.
| Compound Name | [2-[(6S,8S,9S,10R,13S,14S,17S)-6-chloro-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 56605655 |
| Molecular Formula | C26H35ClO5 |
| Molecular Weight | 463.01 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [2-[(6S,8S,9S,10R,13S,14S,17S)-6-chloro-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-hydroxy-2-methylbutanoate |
| SMILES | CC(O)C(C)C(=O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3C[C@H](Cl)C4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H35ClO5/c1-14(15(2)28)24(31)32-13-23(30)20-6-5-18-17-12-22(27)21-11-16(29)7-9-26(21,4)19(17)8-10-25(18,20)3/h7,9,11,14-15,17-20,22,28H,5-6,8,10,12-13H2,1-4H3/t14?,15?,17-,18-,19-,20+,22-,25-,26+/m0/s1 |
| InChIKey | KPWHKJVPMOSZID-ORHCYNAWSA-N |
| XLogP | 4.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.01 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|