C28H42O7 — CID 142963407
acetaldehyde;(6S,9S,14S)-11-hydroxy-17-(2-methoxyacetyl)-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one;propanoic acid (PubChem CID 142963407) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is acetaldehyde;(6S,9S,14S)-11-hydroxy-17-(2-methoxyacetyl)-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one;propanoic acid.
| Compound Name | acetaldehyde;(6S,9S,14S)-11-hydroxy-17-(2-methoxyacetyl)-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one;propanoic acid |
|---|---|
| PubChem CID | 142963407 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | acetaldehyde;(6S,9S,14S)-11-hydroxy-17-(2-methoxyacetyl)-6,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one;propanoic acid |
| SMILES | CC=O.CCC(=O)O.COCC(=O)C1CC[C@H]2C3C[C@H](C)C4=CC(=O)C=CC4(C)[C@H]3C(O)CC12C |
| InChI | InChI=1S/C23H32O4.C3H6O2.C2H4O/c1-13-9-15-16-5-6-17(20(26)12-27-4)23(16,3)11-19(25)21(15)22(2)8-7-14(24)10-18(13)22;1-2-3(4)5;1-2-3/h7-8,10,13,15-17,19,21,25H,5-6,9,11-12H2,1-4H3;2H2,1H3,(H,4,5);2H,1H3/t13-,15?,16-,17?,19?,21+,22?,23?;;/m0../s1 |
| InChIKey | HZTFLWLENGRJLW-IVVSEQLSSA-N |
| XLogP | 4.03 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|