C28H42O7S — CID 177144795
hydroxysulfanyloxyethane;17-(2-methoxyacetyl)-6,10,13-trimethyl-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,11-dione;propanal (PubChem CID 177144795) has the molecular formula C28H42O7S and a molecular weight of 522.70 g/mol. Its IUPAC name is hydroxysulfanyloxyethane;17-(2-methoxyacetyl)-6,10,13-trimethyl-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,11-dione;propanal.
| Compound Name | hydroxysulfanyloxyethane;17-(2-methoxyacetyl)-6,10,13-trimethyl-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,11-dione;propanal |
|---|---|
| PubChem CID | 177144795 |
| Molecular Formula | C28H42O7S |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | hydroxysulfanyloxyethane;17-(2-methoxyacetyl)-6,10,13-trimethyl-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,11-dione;propanal |
| SMILES | CCC=O.CCOSO.COCC(=O)C1CCC2C3CC(C)C4=CC(=O)C=CC4(C)C3C(=O)CC12C |
| InChI | InChI=1S/C23H30O4.C3H6O.C2H6O2S/c1-13-9-15-16-5-6-17(20(26)12-27-4)23(16,3)11-19(25)21(15)22(2)8-7-14(24)10-18(13)22;1-2-3-4;1-2-4-5-3/h7-8,10,13,15-17,21H,5-6,9,11-12H2,1-4H3;3H,2H2,1H3;3H,2H2,1H3 |
| InChIKey | BEVQXENMHLPRRB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|