C27H36O7 — CID 177144803
[2-(3-hydroxy-10,13-dimethyl-11-oxo-7,8,9,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] propanoate;propanoic acid (PubChem CID 177144803) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is [2-(3-hydroxy-10,13-dimethyl-11-oxo-7,8,9,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] propanoate;propanoic acid.
| Compound Name | [2-(3-hydroxy-10,13-dimethyl-11-oxo-7,8,9,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] propanoate;propanoic acid |
|---|---|
| PubChem CID | 177144803 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [2-(3-hydroxy-10,13-dimethyl-11-oxo-7,8,9,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] propanoate;propanoic acid |
| SMILES | CCC(=O)O.CCC(=O)OCC(=O)C1CCC2C3CC=C4C=C(O)C=CC4(C)C3C(=O)CC12C |
| InChI | InChI=1S/C24H30O5.C3H6O2/c1-4-21(28)29-13-20(27)18-8-7-17-16-6-5-14-11-15(25)9-10-23(14,2)22(16)19(26)12-24(17,18)3;1-2-3(4)5/h5,9-11,16-18,22,25H,4,6-8,12-13H2,1-3H3;2H2,1H3,(H,4,5) |
| InChIKey | IGJBXZYPTJYZAS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |