C25H30O5 — CID 57128322
[2-oxo-2-[(8S,9S,10R,13S,14S)-10,13,16-trimethyl-3,11-dioxo-7,8,9,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl] propanoate (PubChem CID 57128322) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is [2-oxo-2-[(8S,9S,10R,13S,14S)-10,13,16-trimethyl-3,11-dioxo-7,8,9,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl] propanoate.
| Compound Name | [2-oxo-2-[(8S,9S,10R,13S,14S)-10,13,16-trimethyl-3,11-dioxo-7,8,9,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl] propanoate |
|---|---|
| PubChem CID | 57128322 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [2-oxo-2-[(8S,9S,10R,13S,14S)-10,13,16-trimethyl-3,11-dioxo-7,8,9,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]ethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)C1=C(C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C25H30O5/c1-5-21(29)30-13-20(28)22-14(2)10-18-17-7-6-15-11-16(26)8-9-24(15,3)23(17)19(27)12-25(18,22)4/h8-9,11,17-18,23H,5-7,10,12-13H2,1-4H3/t17-,18-,23+,24-,25-/m0/s1 |
| InChIKey | FSOZHONELURTML-DUENCVSESA-N |
| XLogP | 3.92 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |