C29H38O8 — CID 22814047
[2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate (PubChem CID 22814047) has the molecular formula C29H38O8 and a molecular weight of 514.62 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 22814047 |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
| SMILES | CCCCOC(=O)O[C@]1(C(=O)COC(=O)CC)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C29H38O8/c1-5-7-14-35-26(34)37-29(23(32)17-36-24(33)6-2)13-11-21-20-9-8-18-15-19(30)10-12-27(18,3)25(20)22(31)16-28(21,29)4/h10,12,15,20-21,25H,5-9,11,13-14,16-17H2,1-4H3/t20-,21-,25+,27-,28-,29-/m0/s1 |
| InChIKey | WEXNFSNTVQIZRY-UDJXSXCLSA-N |
| XLogP | 4.69 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|