C33H38O7 — CID 20747206
[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3,11-dioxo-17-[2-(2-phenylacetyl)oxyacetyl]-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 20747206) has the molecular formula C33H38O7 and a molecular weight of 546.66 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3,11-dioxo-17-[2-(2-phenylacetyl)oxyacetyl]-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3,11-dioxo-17-[2-(2-phenylacetyl)oxyacetyl]-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 20747206 |
| Molecular Formula | C33H38O7 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3,11-dioxo-17-[2-(2-phenylacetyl)oxyacetyl]-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)COC(=O)Cc2ccccc2)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C33H38O7/c1-4-8-28(37)40-33(27(36)20-39-29(38)17-21-9-6-5-7-10-21)16-14-25-24-12-11-22-18-23(34)13-15-31(22,2)30(24)26(35)19-32(25,33)3/h5-7,9-10,13,15,18,24-25,30H,4,8,11-12,14,16-17,19-20H2,1-3H3/t24-,25-,30+,31-,32-,33-/m0/s1 |
| InChIKey | CXVGDEIDVVMYOR-UWDZHMKBSA-N |
| XLogP | 4.91 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |