C29H34O6 — CID 15292945
[(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 2-phenylacetate (PubChem CID 15292945) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 2-phenylacetate.
| Compound Name | [(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 15292945 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 2-phenylacetate |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(OC(=O)Cc1ccccc1)C(=O)CO |
| InChI | InChI=1S/C29H34O6/c1-27-12-10-20(31)15-19(27)8-9-21-22-11-13-29(24(33)17-30,28(22,2)16-23(32)26(21)27)35-25(34)14-18-6-4-3-5-7-18/h3-7,10,12,15,21-23,26,30,32H,8-9,11,13-14,16-17H2,1-2H3/t21-,22-,23-,26+,27-,28-,29-/m0/s1 |
| InChIKey | SIVXJPIZFLNTDU-KAQKJVHQSA-N |
| XLogP | 3.35 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |