C25H33NO9 — CID 67220791
[11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate (PubChem CID 67220791) has the molecular formula C25H33NO9 and a molecular weight of 491.54 g/mol. Its IUPAC name is [11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate.
| Compound Name | [11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 67220791 |
| Molecular Formula | C25H33NO9 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(OC(=O)CCCO[N+](=O)[O-])C(=O)CO |
| InChI | InChI=1S/C25H33NO9/c1-23-9-7-16(28)12-15(23)5-6-17-18-8-10-25(20(30)14-27,24(18,2)13-19(29)22(17)23)35-21(31)4-3-11-34-26(32)33/h7,9,12,17-19,22,27,29H,3-6,8,10-11,13-14H2,1-2H3 |
| InChIKey | IHLGUGCOVGKSGN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|