C26H35NO9 — CID 143936682
[(16R,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate (PubChem CID 143936682) has the molecular formula C26H35NO9 and a molecular weight of 505.56 g/mol. Its IUPAC name is [(16R,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate.
| Compound Name | [(16R,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 143936682 |
| Molecular Formula | C26H35NO9 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | [(16R,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)[C@@]1(OC(=O)CCCO[N+](=O)[O-])C(=O)CO |
| InChI | InChI=1S/C26H35NO9/c1-15-11-19-18-7-6-16-12-17(29)8-9-24(16,2)23(18)20(30)13-25(19,3)26(15,21(31)14-28)36-22(32)5-4-10-35-27(33)34/h8-9,12,15,18-20,23,28,30H,4-7,10-11,13-14H2,1-3H3/t15-,18?,19?,20?,23?,24?,25?,26+/m1/s1 |
| InChIKey | JRJMXRRHOKKFBC-FWWUIKCTSA-N |
| XLogP | 2.34 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|