C25H33FO5S — CID 163928197
[(16R)-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 163928197) has the molecular formula C25H33FO5S and a molecular weight of 464.60 g/mol. Its IUPAC name is [(16R)-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(16R)-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 163928197 |
| Molecular Formula | C25H33FO5S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(16R)-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)OC1(C(=O)SCF)[C@H](C)CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C25H33FO5S/c1-5-20(29)31-25(22(30)32-13-26)14(2)10-18-17-7-6-15-11-16(27)8-9-23(15,3)21(17)19(28)12-24(18,25)4/h8-9,11,14,17-19,21,28H,5-7,10,12-13H2,1-4H3/t14-,17?,18?,19?,21?,23?,24?,25?/m1/s1 |
| InChIKey | RGINBXZZDLGYDX-YJUFTHITSA-N |
| XLogP | 4.39 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|