C24H32O5S — CID 22815660
[(8S,9S,10R,11S,13S,14S,16S,17R)-11-hydroxy-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 22815660) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,16S,17R)-11-hydroxy-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9S,10R,11S,13S,14S,16S,17R)-11-hydroxy-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 22815660 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,16S,17R)-11-hydroxy-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COC(=S)[C@@]1(OC(C)=O)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C24H32O5S/c1-13-10-18-17-7-6-15-11-16(26)8-9-22(15,3)20(17)19(27)12-23(18,4)24(13,21(30)28-5)29-14(2)25/h8-9,11,13,17-20,27H,6-7,10,12H2,1-5H3/t13-,17-,18-,19-,20+,22-,23-,24-/m0/s1 |
| InChIKey | RLEZCVPFUWNLKF-ZPGNWPOBSA-N |
| XLogP | 3.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|