C25H33FO5S — CID 88766320
[(8S,9S,10R,11S,13S,14S,16S,17R)-4-fluoro-11-hydroxy-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88766320) has the molecular formula C25H33FO5S and a molecular weight of 464.60 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,16S,17R)-4-fluoro-11-hydroxy-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9S,10R,11S,13S,14S,16S,17R)-4-fluoro-11-hydroxy-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88766320 |
| Molecular Formula | C25H33FO5S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,16S,17R)-4-fluoro-11-hydroxy-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=S)OC)[C@@H](C)C[C@H]2[C@@H]3CCC4=C(F)C(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C25H33FO5S/c1-6-19(29)31-25(22(32)30-5)13(2)11-16-14-7-8-15-21(26)17(27)9-10-23(15,3)20(14)18(28)12-24(16,25)4/h9-10,13-14,16,18,20,28H,6-8,11-12H2,1-5H3/t13-,14-,16-,18-,20+,23-,24-,25-/m0/s1 |
| InChIKey | WTBHJHAOLMGMJX-BZRJKLRHSA-N |
| XLogP | 4.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|