C25H31F3O5 — CID 88761101
[(6S,8S,9S,10R,11S,13S,14S,16R,17R)-4,6-difluoro-17-(2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88761101) has the molecular formula C25H31F3O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is [(6S,8S,9S,10R,11S,13S,14S,16R,17R)-4,6-difluoro-17-(2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(6S,8S,9S,10R,11S,13S,14S,16R,17R)-4,6-difluoro-17-(2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88761101 |
| Molecular Formula | C25H31F3O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | [(6S,8S,9S,10R,11S,13S,14S,16R,17R)-4,6-difluoro-17-(2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CF)[C@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=C(F)C(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C25H31F3O5/c1-5-19(32)33-25(18(31)11-26)12(2)8-14-13-9-15(27)21-22(28)16(29)6-7-23(21,3)20(13)17(30)10-24(14,25)4/h6-7,12-15,17,20,30H,5,8-11H2,1-4H3/t12-,13+,14+,15+,17+,20-,23-,24+,25+/m1/s1 |
| InChIKey | LSZVHCGQWYQMPN-ZVFAYCCJSA-N |
| XLogP | 3.99 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|