C27H38F2O5 — CID 70561907
(8S,9S,10R,13S,14S,17R)-4,6-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-17-pentoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 70561907) has the molecular formula C27H38F2O5 and a molecular weight of 480.59 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-4,6-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-17-pentoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-4,6-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-17-pentoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70561907 |
| Molecular Formula | C27H38F2O5 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-4,6-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-17-pentoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCCCO[C@]1(C(=O)CO)C(C)C[C@H]2[C@@H]3CC(F)C4=C(F)C(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C27H38F2O5/c1-5-6-7-10-34-27(21(33)14-30)15(2)11-17-16-12-18(28)23-24(29)19(31)8-9-25(23,3)22(16)20(32)13-26(17,27)4/h8-9,15-18,20,22,30,32H,5-7,10-14H2,1-4H3/t15?,16-,17-,18?,20?,22+,25+,26-,27-/m0/s1 |
| InChIKey | OEMYHDMIVFQOJR-RFLRMGHKSA-N |
| XLogP | 4.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|