C28H42O6 — CID 70822228
(8S,10R,11S,13S,16R,17S)-17-butoxy-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 70822228) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is (8S,10R,11S,13S,16R,17S)-17-butoxy-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10R,11S,13S,16R,17S)-17-butoxy-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70822228 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (8S,10R,11S,13S,16R,17S)-17-butoxy-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCCO[C@]1(C(=O)CO)[C@H](OCCC)CC2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3C(O)C[C@@]21C |
| InChI | InChI=1S/C28H42O6/c1-5-7-13-34-28(23(32)17-29)24(33-12-6-2)15-21-20-9-8-18-14-19(30)10-11-26(18,3)25(20)22(31)16-27(21,28)4/h10-11,14,20-22,24-25,29,31H,5-9,12-13,15-17H2,1-4H3/t20-,21?,22?,24+,25?,26-,27-,28+/m0/s1 |
| InChIKey | ADCCLTZDCIWXGV-UDDZQKNISA-N |
| XLogP | 3.79 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|