C27H40O5 — CID 123526415
11-hydroxy-17-(2-hydroxyacetyl)-10,13,17-trimethyl-16-pentan-2-yloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 123526415) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is 11-hydroxy-17-(2-hydroxyacetyl)-10,13,17-trimethyl-16-pentan-2-yloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 11-hydroxy-17-(2-hydroxyacetyl)-10,13,17-trimethyl-16-pentan-2-yloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123526415 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | 11-hydroxy-17-(2-hydroxyacetyl)-10,13,17-trimethyl-16-pentan-2-yloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCC(C)OC1CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)C1(C)C(=O)CO |
| InChI | InChI=1S/C27H40O5/c1-6-7-16(2)32-23-13-20-19-9-8-17-12-18(29)10-11-25(17,3)24(19)21(30)14-26(20,4)27(23,5)22(31)15-28/h10-12,16,19-21,23-24,28,30H,6-9,13-15H2,1-5H3 |
| InChIKey | NUASMJNUKCPURQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |