C23H32O6 — CID 158223991
(10R,13S)-11-hydroxy-17-(2-hydroxyacetyl)-16,17-dimethoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 158223991) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is (10R,13S)-11-hydroxy-17-(2-hydroxyacetyl)-16,17-dimethoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S)-11-hydroxy-17-(2-hydroxyacetyl)-16,17-dimethoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 158223991 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (10R,13S)-11-hydroxy-17-(2-hydroxyacetyl)-16,17-dimethoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | COC1CC2C3CCC4=CC(=O)C=C[C@]4(C)C3C(O)C[C@]2(C)C1(OC)C(=O)CO |
| InChI | InChI=1S/C23H32O6/c1-21-8-7-14(25)9-13(21)5-6-15-16-10-19(28-3)23(29-4,18(27)12-24)22(16,2)11-17(26)20(15)21/h7-9,15-17,19-20,24,26H,5-6,10-12H2,1-4H3/t15?,16?,17?,19?,20?,21-,22-,23?/m0/s1 |
| InChIKey | CHZAQNMDBWDTQW-ABPNMJEQSA-N |
| XLogP | 1.84 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |