C24H34O9S — CID 88831867
2-[[(8S,9S,10R,13S,14S,17S)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]oxy]ethyl methanesulfonate (PubChem CID 88831867) has the molecular formula C24H34O9S and a molecular weight of 498.59 g/mol. Its IUPAC name is 2-[[(8S,9S,10R,13S,14S,17S)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]oxy]ethyl methanesulfonate.
| Compound Name | 2-[[(8S,9S,10R,13S,14S,17S)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]oxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 88831867 |
| Molecular Formula | C24H34O9S |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-[[(8S,9S,10R,13S,14S,17S)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]oxy]ethyl methanesulfonate |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2C(O)C[C@@]2(C)[C@H]1CC(OCCOS(C)(=O)=O)[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C24H34O9S/c1-22-7-6-15(26)10-14(22)4-5-16-17-11-20(32-8-9-33-34(3,30)31)24(29,19(28)13-25)23(17,2)12-18(27)21(16)22/h6-7,10,16-18,20-21,25,27,29H,4-5,8-9,11-13H2,1-3H3/t16-,17-,18?,20?,21+,22-,23-,24+/m0/s1 |
| InChIKey | JECHZUMFVDQRDD-RPJXECEHSA-N |
| XLogP | 0.53 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|